C13H26N4O2S2 — CID 119155535
1-(cyclobutylmethyl)-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 119155535) has the molecular formula C13H26N4O2S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-(cyclobutylmethyl)-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 119155535 |
| Molecular Formula | C13H26N4O2S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(cyclobutylmethyl)-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CCSCC1)NCC1CCC1 |
| InChI | InChI=1S/C13H26N4O2S2/c1-14-13(16-11-12-3-2-4-12)15-5-10-21(18,19)17-6-8-20-9-7-17/h12H,2-11H2,1H3,(H2,14,15,16) |
| InChIKey | MYCMHMUHJWAHQO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|