C16H27IN4O3S2 — CID 111833204
1-[(4-methoxyphenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111833204) has the molecular formula C16H27IN4O3S2 and a molecular weight of 514.46 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111833204 |
| Molecular Formula | C16H27IN4O3S2 |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCSCC1)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C16H26N4O3S2.HI/c1-17-16(19-13-14-3-5-15(23-2)6-4-14)18-7-12-25(21,22)20-8-10-24-11-9-20;/h3-6H,7-13H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | HVBUUVJIWYIPJB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|