C18H29IN4O3S2 — CID 111982546
2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111982546) has the molecular formula C18H29IN4O3S2 and a molecular weight of 540.49 g/mol. Its IUPAC name is 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111982546 |
| Molecular Formula | C18H29IN4O3S2 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | 2-methyl-1-[(2-prop-2-enoxyphenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N/C)NCCS(=O)(=O)N1CCSCC1.I |
| InChI | InChI=1S/C18H28N4O3S2.HI/c1-3-11-25-17-7-5-4-6-16(17)15-21-18(19-2)20-8-14-27(23,24)22-9-12-26-13-10-22;/h3-7H,1,8-15H2,2H3,(H2,19,20,21);1H |
| InChIKey | SZCOVRRFGDBWGQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|