C15H25IN4O2S2 — CID 111546160
1-benzyl-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111546160) has the molecular formula C15H25IN4O2S2 and a molecular weight of 484.43 g/mol. Its IUPAC name is 1-benzyl-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-benzyl-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111546160 |
| Molecular Formula | C15H25IN4O2S2 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 1-benzyl-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CCSCC1)NCc1ccccc1.I |
| InChI | InChI=1S/C15H24N4O2S2.HI/c1-16-15(18-13-14-5-3-2-4-6-14)17-7-12-23(20,21)19-8-10-22-11-9-19;/h2-6H,7-13H2,1H3,(H2,16,17,18);1H |
| InChIKey | FBKONPDDEIEGDO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|