C15H23ClN4O2S2 — CID 111833123
1-[(4-chlorophenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111833123) has the molecular formula C15H23ClN4O2S2 and a molecular weight of 390.96 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111833123 |
| Molecular Formula | C15H23ClN4O2S2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCSCC1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H23ClN4O2S2/c1-17-15(19-12-13-2-4-14(16)5-3-13)18-6-11-24(21,22)20-7-9-23-10-8-20/h2-5H,6-12H2,1H3,(H2,17,18,19) |
| InChIKey | TUKDMAUMQIEJDN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|