C15H31N5O2S2 — CID 111833647
2-methyl-1-(2-piperidin-1-ylethyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111833647) has the molecular formula C15H31N5O2S2 and a molecular weight of 377.58 g/mol. Its IUPAC name is 2-methyl-1-(2-piperidin-1-ylethyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 2-methyl-1-(2-piperidin-1-ylethyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111833647 |
| Molecular Formula | C15H31N5O2S2 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 2-methyl-1-(2-piperidin-1-ylethyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCN1CCCCC1)NCCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C15H31N5O2S2/c1-16-15(17-5-9-19-7-3-2-4-8-19)18-6-14-24(21,22)20-10-12-23-13-11-20/h2-14H2,1H3,(H2,16,17,18) |
| InChIKey | UBFWFOUSIKIGON-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|