C13H29N5O2S — CID 111416367
1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine (PubChem CID 111416367) has the molecular formula C13H29N5O2S and a molecular weight of 319.48 g/mol. Its IUPAC name is 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111416367 |
| Molecular Formula | C13H29N5O2S |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)NCCN1CCCCC1 |
| InChI | InChI=1S/C13H29N5O2S/c1-3-21(19,20)17-8-7-15-13(14-2)16-9-12-18-10-5-4-6-11-18/h17H,3-12H2,1-2H3,(H2,14,15,16) |
| InChIKey | PDHYOACTQMHXGV-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|