C13H27IN4O3S2 — CID 111833136
2-methyl-1-(oxolan-2-ylmethyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111833136) has the molecular formula C13H27IN4O3S2 and a molecular weight of 478.42 g/mol. Its IUPAC name is 2-methyl-1-(oxolan-2-ylmethyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111833136 |
| Molecular Formula | C13H27IN4O3S2 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 2-methyl-1-(oxolan-2-ylmethyl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CCSCC1)NCC1CCCO1.I |
| InChI | InChI=1S/C13H26N4O3S2.HI/c1-14-13(16-11-12-3-2-7-20-12)15-4-10-22(18,19)17-5-8-21-9-6-17;/h12H,2-11H2,1H3,(H2,14,15,16);1H |
| InChIKey | RCUBVMYHLOKHBA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|