C15H24FIN4O3S — CID 111876852
1-[(3-fluorophenyl)methyl]-2-methyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111876852) has the molecular formula C15H24FIN4O3S and a molecular weight of 486.35 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2-methyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111876852 |
| Molecular Formula | C15H24FIN4O3S |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCOCC1)NCc1cccc(F)c1.I |
| InChI | InChI=1S/C15H23FN4O3S.HI/c1-17-15(19-12-13-3-2-4-14(16)11-13)18-5-10-24(21,22)20-6-8-23-9-7-20;/h2-4,11H,5-10,12H2,1H3,(H2,17,18,19);1H |
| InChIKey | SUYAIKZRWPGJHB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|