C18H27FN4OS — CID 111876329
1-[(3-fluorophenyl)methyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine (PubChem CID 111876329) has the molecular formula C18H27FN4OS and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111876329 |
| Molecular Formula | C18H27FN4OS |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1cccc(F)c1)NCC1(N2CCOCC2)CCSC1 |
| InChI | InChI=1S/C18H27FN4OS/c1-20-17(21-12-15-3-2-4-16(19)11-15)22-13-18(5-10-25-14-18)23-6-8-24-9-7-23/h2-4,11H,5-10,12-14H2,1H3,(H2,20,21,22) |
| InChIKey | FUBSTGCUGILNPH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|