C22H32IN5O2S — CID 111591222
2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111591222) has the molecular formula C22H32IN5O2S and a molecular weight of 557.50 g/mol. Its IUPAC name is 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111591222 |
| Molecular Formula | C22H32IN5O2S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 2-methyl-1-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1coc(-c2ccc(C)cc2)n1)NCC1(N2CCOCC2)CCSC1.I |
| InChI | InChI=1S/C22H31N5O2S.HI/c1-17-3-5-18(6-4-17)20-26-19(14-29-20)13-24-21(23-2)25-15-22(7-12-30-16-22)27-8-10-28-11-9-27;/h3-6,14H,7-13,15-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | XMQKZGISBJMAHJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|