C17H29IN4OS2 — CID 111897728
2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111897728) has the molecular formula C17H29IN4OS2 and a molecular weight of 496.48 g/mol. Its IUPAC name is 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111897728 |
| Molecular Formula | C17H29IN4OS2 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 2-methyl-1-[(5-methylthiophen-2-yl)methyl]-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(C)s1)NCC1(N2CCOCC2)CCSC1.I |
| InChI | InChI=1S/C17H28N4OS2.HI/c1-14-3-4-15(24-14)11-19-16(18-2)20-12-17(5-10-23-13-17)21-6-8-22-9-7-21;/h3-4H,5-13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | DNRXHBJUIRKICG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|