C19H31IN4OS — CID 110947889
2-methyl-1-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide (PubChem CID 110947889) has the molecular formula C19H31IN4OS and a molecular weight of 490.46 g/mol. Its IUPAC name is 2-methyl-1-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110947889 |
| Molecular Formula | C19H31IN4OS |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-methyl-1-[(3-morpholin-4-ylthiolan-3-yl)methyl]-3-(1-phenylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(N2CCOCC2)CCSC1)NC(C)c1ccccc1.I |
| InChI | InChI=1S/C19H30N4OS.HI/c1-16(17-6-4-3-5-7-17)22-18(20-2)21-14-19(8-13-25-15-19)23-9-11-24-12-10-23;/h3-7,16H,8-15H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | SNFGSSAKKLVYQZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|