C22H38IN5OS — CID 111390262
1-[3-(N-ethylanilino)propyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111390262) has the molecular formula C22H38IN5OS and a molecular weight of 547.55 g/mol. Its IUPAC name is 1-[3-(N-ethylanilino)propyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(N-ethylanilino)propyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111390262 |
| Molecular Formula | C22H38IN5OS |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | 1-[3-(N-ethylanilino)propyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN(CCCN/C(=N\C)NCC1(N2CCOCC2)CCSC1)c1ccccc1.I |
| InChI | InChI=1S/C22H37N5OS.HI/c1-3-26(20-8-5-4-6-9-20)12-7-11-24-21(23-2)25-18-22(10-17-29-19-22)27-13-15-28-16-14-27;/h4-6,8-9H,3,7,10-19H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | DPBGVANUDJHZBD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|