C23H40IN5OS — CID 111718991
1-[3-[benzyl(methyl)amino]butyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111718991) has the molecular formula C23H40IN5OS and a molecular weight of 561.58 g/mol. Its IUPAC name is 1-[3-[benzyl(methyl)amino]butyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-[benzyl(methyl)amino]butyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111718991 |
| Molecular Formula | C23H40IN5OS |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 1-[3-[benzyl(methyl)amino]butyl]-2-methyl-3-[(3-morpholin-4-ylthiolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC(C)N(C)Cc1ccccc1)NCC1(N2CCOCC2)CCSC1.I |
| InChI | InChI=1S/C23H39N5OS.HI/c1-20(27(3)17-21-7-5-4-6-8-21)9-11-25-22(24-2)26-18-23(10-16-30-19-23)28-12-14-29-15-13-28;/h4-8,20H,9-19H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | LBCPOJHZEGESLU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|