C19H30N4O3S2 — CID 111982711
1-ethyl-2-[(2-prop-2-enoxyphenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111982711) has the molecular formula C19H30N4O3S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-ethyl-2-[(2-prop-2-enoxyphenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(2-prop-2-enoxyphenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111982711 |
| Molecular Formula | C19H30N4O3S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-ethyl-2-[(2-prop-2-enoxyphenyl)methyl]-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | C=CCOc1ccccc1C/N=C(\NCC)NCCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C19H30N4O3S2/c1-3-12-26-18-8-6-5-7-17(18)16-22-19(20-4-2)21-9-15-28(24,25)23-10-13-27-14-11-23/h3,5-8H,1,4,9-16H2,2H3,(H2,20,21,22) |
| InChIKey | IRLFFOSYZBMVGL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|