C21H28N4O3S — CID 111555665
1-ethyl-3-[[2-(methanesulfonamido)phenyl]methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine (PubChem CID 111555665) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-ethyl-3-[[2-(methanesulfonamido)phenyl]methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[2-(methanesulfonamido)phenyl]methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111555665 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1-ethyl-3-[[2-(methanesulfonamido)phenyl]methyl]-2-[(2-prop-2-enoxyphenyl)methyl]guanidine |
| SMILES | C=CCOc1ccccc1C/N=C(\NCC)NCc1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C21H28N4O3S/c1-4-14-28-20-13-9-7-11-18(20)16-24-21(22-5-2)23-15-17-10-6-8-12-19(17)25-29(3,26)27/h4,6-13,25H,1,5,14-16H2,2-3H3,(H2,22,23,24) |
| InChIKey | CDPOFRGXPHOHQS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|