C15H29N5O2S2 — CID 119155057
1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 119155057) has the molecular formula C15H29N5O2S2 and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 119155057 |
| Molecular Formula | C15H29N5O2S2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-(1-cyclopropylpyrrolidin-3-yl)-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCSCC1)NC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C15H29N5O2S2/c1-16-15(18-13-4-6-19(12-13)14-2-3-14)17-5-11-24(21,22)20-7-9-23-10-8-20/h13-14H,2-12H2,1H3,(H2,16,17,18) |
| InChIKey | SKYVROOIPDHGHY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|