C13H25N5O3S2 — CID 119155071
2-methyl-1-(6-oxopiperidin-3-yl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 119155071) has the molecular formula C13H25N5O3S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-methyl-1-(6-oxopiperidin-3-yl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 2-methyl-1-(6-oxopiperidin-3-yl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 119155071 |
| Molecular Formula | C13H25N5O3S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-methyl-1-(6-oxopiperidin-3-yl)-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCSCC1)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C13H25N5O3S2/c1-14-13(17-11-2-3-12(19)16-10-11)15-4-9-23(20,21)18-5-7-22-8-6-18/h11H,2-10H2,1H3,(H,16,19)(H2,14,15,17) |
| InChIKey | LRDZAJWXYQPDRN-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|