C13H25N5OS — CID 119153906
2-methyl-1-(6-oxopiperidin-3-yl)-3-(2-thiomorpholin-4-ylethyl)guanidine (PubChem CID 119153906) has the molecular formula C13H25N5OS and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-methyl-1-(6-oxopiperidin-3-yl)-3-(2-thiomorpholin-4-ylethyl)guanidine.
| Compound Name | 2-methyl-1-(6-oxopiperidin-3-yl)-3-(2-thiomorpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 119153906 |
| Molecular Formula | C13H25N5OS |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-methyl-1-(6-oxopiperidin-3-yl)-3-(2-thiomorpholin-4-ylethyl)guanidine |
| SMILES | C/N=C(\NCCN1CCSCC1)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C13H25N5OS/c1-14-13(17-11-2-3-12(19)16-10-11)15-4-5-18-6-8-20-9-7-18/h11H,2-10H2,1H3,(H,16,19)(H2,14,15,17) |
| InChIKey | GKCQHWJTCCDDAI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|