C14H25N7O — CID 119159768
1-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methyl-3-(6-oxopiperidin-3-yl)guanidine (PubChem CID 119159768) has the molecular formula C14H25N7O and a molecular weight of 307.40 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methyl-3-(6-oxopiperidin-3-yl)guanidine.
| Compound Name | 1-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methyl-3-(6-oxopiperidin-3-yl)guanidine |
|---|---|
| PubChem CID | 119159768 |
| Molecular Formula | C14H25N7O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 1-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methyl-3-(6-oxopiperidin-3-yl)guanidine |
| SMILES | C/N=C(\NCc1cnc(N(C)C)n1C)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C14H25N7O/c1-15-13(19-10-5-6-12(22)16-7-10)17-8-11-9-18-14(20(2)3)21(11)4/h9-10H,5-8H2,1-4H3,(H,16,22)(H2,15,17,19) |
| InChIKey | IXACMYXSJJWIRM-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|