C20H32IN7 — CID 119159858
1-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methyl-3-(1-phenylpiperidin-3-yl)guanidine;hydroiodide (PubChem CID 119159858) has the molecular formula C20H32IN7 and a molecular weight of 497.43 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methyl-3-(1-phenylpiperidin-3-yl)guanidine;hydroiodide.
| Compound Name | 1-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methyl-3-(1-phenylpiperidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119159858 |
| Molecular Formula | C20H32IN7 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-2-methyl-3-(1-phenylpiperidin-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cnc(N(C)C)n1C)NC1CCCN(c2ccccc2)C1.I |
| InChI | InChI=1S/C20H31N7.HI/c1-21-19(22-13-18-14-23-20(25(2)3)26(18)4)24-16-9-8-12-27(15-16)17-10-6-5-7-11-17;/h5-7,10-11,14,16H,8-9,12-13,15H2,1-4H3,(H2,21,22,24);1H |
| InChIKey | LDYZBGIRWIYGKC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|