C16H24IN7 — CID 111910568
2-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide (PubChem CID 111910568) has the molecular formula C16H24IN7 and a molecular weight of 441.32 g/mol. Its IUPAC name is 2-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111910568 |
| Molecular Formula | C16H24IN7 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-methyl-1-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nncn1C)NC1CCN(c2ccccc2)C1.I |
| InChI | InChI=1S/C16H23N7.HI/c1-17-16(18-10-15-21-19-12-22(15)2)20-13-8-9-23(11-13)14-6-4-3-5-7-14;/h3-7,12-13H,8-11H2,1-2H3,(H2,17,18,20);1H |
| InChIKey | QVXRFUJOCBIDGB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|