C12H23N5O2 — CID 119158441
2-[[N'-methyl-N-(6-oxopiperidin-3-yl)carbamimidoyl]amino]-N-propan-2-ylacetamide (PubChem CID 119158441) has the molecular formula C12H23N5O2 and a molecular weight of 269.35 g/mol. Its IUPAC name is 2-[[N'-methyl-N-(6-oxopiperidin-3-yl)carbamimidoyl]amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[N'-methyl-N-(6-oxopiperidin-3-yl)carbamimidoyl]amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 119158441 |
| Molecular Formula | C12H23N5O2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 2-[[N'-methyl-N-(6-oxopiperidin-3-yl)carbamimidoyl]amino]-N-propan-2-ylacetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)C)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C12H23N5O2/c1-8(2)16-11(19)7-15-12(13-3)17-9-4-5-10(18)14-6-9/h8-9H,4-7H2,1-3H3,(H,14,18)(H,16,19)(H2,13,15,17) |
| InChIKey | ICBVOCKMOVMXDJ-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|