C9H17N3O2 — CID 63663000
2-(methylamino)-N-(6-oxopiperidin-3-yl)propanamide (PubChem CID 63663000) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(methylamino)-N-(6-oxopiperidin-3-yl)propanamide.
| Compound Name | 2-(methylamino)-N-(6-oxopiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 63663000 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-(methylamino)-N-(6-oxopiperidin-3-yl)propanamide |
| SMILES | CNC(C)C(=O)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C9H17N3O2/c1-6(10-2)9(14)12-7-3-4-8(13)11-5-7/h6-7,10H,3-5H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | JTAMOVNXFDZXGB-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |