C6H10N2O3 — CID 77299994
(6-oxopiperidin-3-yl)carbamic acid (PubChem CID 77299994) has the molecular formula C6H10N2O3 and a molecular weight of 158.16 g/mol. Its IUPAC name is (6-oxopiperidin-3-yl)carbamic acid.
| Compound Name | (6-oxopiperidin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 77299994 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | (6-oxopiperidin-3-yl)carbamic acid |
| SMILES | O=C(O)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C6H10N2O3/c9-5-2-1-4(3-7-5)8-6(10)11/h4,8H,1-3H2,(H,7,9)(H,10,11) |
| InChIKey | RJXAXWUHGHCKQK-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |