C15H18N2O4 — CID 103429074
3,6-dimethyl-2-[(6-oxopiperidin-3-yl)carbamoyl]benzoic acid (PubChem CID 103429074) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3,6-dimethyl-2-[(6-oxopiperidin-3-yl)carbamoyl]benzoic acid.
| Compound Name | 3,6-dimethyl-2-[(6-oxopiperidin-3-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 103429074 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3,6-dimethyl-2-[(6-oxopiperidin-3-yl)carbamoyl]benzoic acid |
| SMILES | Cc1ccc(C)c(C(=O)NC2CCC(=O)NC2)c1C(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-8-3-4-9(2)13(15(20)21)12(8)14(19)17-10-5-6-11(18)16-7-10/h3-4,10H,5-7H2,1-2H3,(H,16,18)(H,17,19)(H,20,21) |
| InChIKey | JBJUTTGAJWZTSV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |