C12H18N4O2 — CID 62896612
1,3,5-trimethyl-N-(6-oxopiperidin-3-yl)pyrazole-4-carboxamide (PubChem CID 62896612) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-(6-oxopiperidin-3-yl)pyrazole-4-carboxamide.
| Compound Name | 1,3,5-trimethyl-N-(6-oxopiperidin-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 62896612 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1,3,5-trimethyl-N-(6-oxopiperidin-3-yl)pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)c(C)c1C(=O)NC1CCC(=O)NC1 |
| InChI | InChI=1S/C12H18N4O2/c1-7-11(8(2)16(3)15-7)12(18)14-9-4-5-10(17)13-6-9/h9H,4-6H2,1-3H3,(H,13,17)(H,14,18) |
| InChIKey | DQRHFGHQTTUBMH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |