C7H9F3N2O2 — CID 63374613
2,2,2-trifluoro-N-(6-oxopiperidin-3-yl)acetamide (PubChem CID 63374613) has the molecular formula C7H9F3N2O2 and a molecular weight of 210.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(6-oxopiperidin-3-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(6-oxopiperidin-3-yl)acetamide |
|---|---|
| PubChem CID | 63374613 |
| Molecular Formula | C7H9F3N2O2 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2,2,2-trifluoro-N-(6-oxopiperidin-3-yl)acetamide |
| SMILES | O=C1CCC(NC(=O)C(F)(F)F)CN1 |
| InChI | InChI=1S/C7H9F3N2O2/c8-7(9,10)6(14)12-4-1-2-5(13)11-3-4/h4H,1-3H2,(H,11,13)(H,12,14) |
| InChIKey | QVPNVUFCBFZCRH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |