About sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide
sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide (PubChem CID 161088064) has the molecular formula C6H11F3N2OS
and a molecular weight of 216.23 g/mol. Its IUPAC name is sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide.
Molecular Properties
| Compound Name | sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide |
| PubChem CID | 161088064 |
| Molecular Formula | C6H11F3N2OS |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide |
| SMILES | O=C(N[C@H]1CCNC1)C(F)(F)F.S |
| InChI | InChI=1S/C6H9F3N2O.H2S/c7-6(8,9)5(12)11-4-1-2-10-3-4;/h4,10H,1-3H2,(H,11,12);1H2/t4-;/m0./s1 |
| InChIKey | UGUGHWHRIGDCEI-WCCKRBBISA-N |
| XLogP | 0.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide?
The IUPAC name of sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide (CID 161088064) is sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide.
What is the SMILES notation for sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide?
The canonical SMILES for sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide is O=C(N[C@H]1CCNC1)C(F)(F)F.S.
What is the InChIKey of sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide?
The InChIKey is UGUGHWHRIGDCEI-WCCKRBBISA-N. The full InChI is InChI=1S/C6H9F3N2O.H2S/c7-6(8,9)5(12)11-4-1-2-10-3-4;/h4,10H,1-3H2,(H,11,12);1H2/t4-;/m0./s1.
What are the key properties of sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide?
sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide has a molecular weight of 216.23 g/mol, XLogP of 0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide is sourced from PubChem (CID 161088064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).