C6H11F3N2OS — CID 161088064
sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide (PubChem CID 161088064) has the molecular formula C6H11F3N2OS and a molecular weight of 216.23 g/mol. Its IUPAC name is sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide.
| Compound Name | sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 161088064 |
| Molecular Formula | C6H11F3N2OS |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | sulfane;2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide |
| SMILES | O=C(N[C@H]1CCNC1)C(F)(F)F.S |
| InChI | InChI=1S/C6H9F3N2O.H2S/c7-6(8,9)5(12)11-4-1-2-10-3-4;/h4,10H,1-3H2,(H,11,12);1H2/t4-;/m0./s1 |
| InChIKey | UGUGHWHRIGDCEI-WCCKRBBISA-N |
| XLogP | 0.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |