About 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide
3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide (PubChem CID 144537745) has the molecular formula C8H15F3N2O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide.
Molecular Properties
| Compound Name | 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide |
| PubChem CID | 144537745 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide |
| SMILES | CC1CCNC1.CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C5H11N.C3H4F3NO/c1-5-2-3-6-4-5;1-7-2(8)3(4,5)6/h5-6H,2-4H2,1H3;1H3,(H,7,8) |
| InChIKey | NARAIPFXHDGTRC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide?
The IUPAC name of 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide (CID 144537745) is 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide.
What is the SMILES notation for 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide?
The canonical SMILES for 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide is CC1CCNC1.CNC(=O)C(F)(F)F.
What is the InChIKey of 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide?
The InChIKey is NARAIPFXHDGTRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N.C3H4F3NO/c1-5-2-3-6-4-5;1-7-2(8)3(4,5)6/h5-6H,2-4H2,1H3;1H3,(H,7,8).
What are the key properties of 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide?
3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide has a molecular weight of 212.21 g/mol, XLogP of 0.91, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyrrolidine;2,2,2-trifluoro-N-methylacetamide is sourced from PubChem (CID 144537745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).