C8H12F4N2O — CID 103805389
2,2,3,3-tetrafluoro-N-piperidin-3-ylpropanamide (PubChem CID 103805389) has the molecular formula C8H12F4N2O and a molecular weight of 228.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-piperidin-3-ylpropanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 103805389 |
| Molecular Formula | C8H12F4N2O |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-piperidin-3-ylpropanamide |
| SMILES | O=C(NC1CCCNC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H12F4N2O/c9-6(10)8(11,12)7(15)14-5-2-1-3-13-4-5/h5-6,13H,1-4H2,(H,14,15) |
| InChIKey | NPNUITWDSRYJJA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|