C9H15F3N2O — CID 119424701
3,3,3-trifluoro-2-methyl-N-piperidin-3-ylpropanamide (PubChem CID 119424701) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-N-piperidin-3-ylpropanamide.
| Compound Name | 3,3,3-trifluoro-2-methyl-N-piperidin-3-ylpropanamide |
|---|---|
| PubChem CID | 119424701 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-N-piperidin-3-ylpropanamide |
| SMILES | CC(C(=O)NC1CCCNC1)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O/c1-6(9(10,11)12)8(15)14-7-3-2-4-13-5-7/h6-7,13H,2-5H2,1H3,(H,14,15) |
| InChIKey | IKZKTIZDWXHBKK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |