C12H18F4N2O — CID 103734026
2,2,3,3-tetrafluoro-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)propanamide (PubChem CID 103734026) has the molecular formula C12H18F4N2O and a molecular weight of 282.28 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)propanamide |
|---|---|
| PubChem CID | 103734026 |
| Molecular Formula | C12H18F4N2O |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)propanamide |
| SMILES | CN1C2CCCC1CC(NC(=O)C(F)(F)C(F)F)C2 |
| InChI | InChI=1S/C12H18F4N2O/c1-18-8-3-2-4-9(18)6-7(5-8)17-11(19)12(15,16)10(13)14/h7-10H,2-6H2,1H3,(H,17,19) |
| InChIKey | DNYOVZYEFVNOIB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|