About [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid (PubChem CID 67915994) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid.
Analyze [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid?
The IUPAC name of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid (CID 67915994) is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid.
What is the SMILES notation for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid?
The canonical SMILES for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid is CN1[C@@H]2CC[C@H]1CC(NC(=O)O)C2.
What is the InChIKey of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid?
The InChIKey is SPAIQORGWQWFGO-IEESLHIDSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-11-7-2-3-8(11)5-6(4-7)10-9(12)13/h6-8,10H,2-5H2,1H3,(H,12,13)/t6?,7-,8+.
What are the key properties of [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid?
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid has a molecular weight of 184.24 g/mol, XLogP of 0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]carbamic acid is sourced from PubChem (CID 67915994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).