C10H15Cl3N2O — CID 67833389
2,2,2-trichloro-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]acetamide (PubChem CID 67833389) has the molecular formula C10H15Cl3N2O and a molecular weight of 285.60 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 67833389 |
| Molecular Formula | C10H15Cl3N2O |
| Molecular Weight | 285.60 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2,2,2-trichloro-N-[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]acetamide |
| SMILES | CN1[C@@H]2CC[C@H]1CC(NC(=O)C(Cl)(Cl)Cl)C2 |
| InChI | InChI=1S/C10H15Cl3N2O/c1-15-7-2-3-8(15)5-6(4-7)14-9(16)10(11,12)13/h6-8H,2-5H2,1H3,(H,14,16)/t6?,7-,8+ |
| InChIKey | UJWPDSPXXQPEIE-IEESLHIDSA-N |
| XLogP | 2.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.60 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|