C8H12F4N2O — CID 103733776
2,2,3,3-tetrafluoro-N-(1-methylpyrrolidin-3-yl)propanamide (PubChem CID 103733776) has the molecular formula C8H12F4N2O and a molecular weight of 228.19 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(1-methylpyrrolidin-3-yl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(1-methylpyrrolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 103733776 |
| Molecular Formula | C8H12F4N2O |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(1-methylpyrrolidin-3-yl)propanamide |
| SMILES | CN1CCC(NC(=O)C(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C8H12F4N2O/c1-14-3-2-5(4-14)13-7(15)8(11,12)6(9)10/h5-6H,2-4H2,1H3,(H,13,15) |
| InChIKey | GRGVGOQWPCEGSF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|