About pyrrolidin-3-ylcarbamic acid;hydrochloride
pyrrolidin-3-ylcarbamic acid;hydrochloride (PubChem CID 141142005) has the molecular formula C5H11ClN2O2
and a molecular weight of 166.61 g/mol. Its IUPAC name is pyrrolidin-3-ylcarbamic acid;hydrochloride.
Molecular Properties
| Compound Name | pyrrolidin-3-ylcarbamic acid;hydrochloride |
| PubChem CID | 141142005 |
| Molecular Formula | C5H11ClN2O2 |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | pyrrolidin-3-ylcarbamic acid;hydrochloride |
| SMILES | Cl.O=C(O)NC1CCNC1 |
| InChI | InChI=1S/C5H10N2O2.ClH/c8-5(9)7-4-1-2-6-3-4;/h4,6-7H,1-3H2,(H,8,9);1H |
| InChIKey | MGAGMFQGDITVMA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pyrrolidin-3-ylcarbamic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-3-ylcarbamic acid;hydrochloride?
The IUPAC name of pyrrolidin-3-ylcarbamic acid;hydrochloride (CID 141142005) is pyrrolidin-3-ylcarbamic acid;hydrochloride.
What is the SMILES notation for pyrrolidin-3-ylcarbamic acid;hydrochloride?
The canonical SMILES for pyrrolidin-3-ylcarbamic acid;hydrochloride is Cl.O=C(O)NC1CCNC1.
What is the InChIKey of pyrrolidin-3-ylcarbamic acid;hydrochloride?
The InChIKey is MGAGMFQGDITVMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2.ClH/c8-5(9)7-4-1-2-6-3-4;/h4,6-7H,1-3H2,(H,8,9);1H.
What are the key properties of pyrrolidin-3-ylcarbamic acid;hydrochloride?
pyrrolidin-3-ylcarbamic acid;hydrochloride has a molecular weight of 166.61 g/mol, XLogP of 0.04, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-ylcarbamic acid;hydrochloride is sourced from PubChem (CID 141142005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).