C7H12N2O6 — CID 66616538
oxalic acid;pyrrolidin-3-ylcarbamic acid (PubChem CID 66616538) has the molecular formula C7H12N2O6 and a molecular weight of 220.18 g/mol. Its IUPAC name is oxalic acid;pyrrolidin-3-ylcarbamic acid.
| Compound Name | oxalic acid;pyrrolidin-3-ylcarbamic acid |
|---|---|
| PubChem CID | 66616538 |
| Molecular Formula | C7H12N2O6 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | oxalic acid;pyrrolidin-3-ylcarbamic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)NC1CCNC1 |
| InChI | InChI=1S/C5H10N2O2.C2H2O4/c8-5(9)7-4-1-2-6-3-4;3-1(4)2(5)6/h4,6-7H,1-3H2,(H,8,9);(H,3,4)(H,5,6) |
| InChIKey | VGBBTZGWUUUILW-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|