C8H13ClN2O2 — CID 63662078
3-chloro-N-(6-oxopiperidin-3-yl)propanamide (PubChem CID 63662078) has the molecular formula C8H13ClN2O2 and a molecular weight of 204.66 g/mol. Its IUPAC name is 3-chloro-N-(6-oxopiperidin-3-yl)propanamide.
| Compound Name | 3-chloro-N-(6-oxopiperidin-3-yl)propanamide |
|---|---|
| PubChem CID | 63662078 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3-chloro-N-(6-oxopiperidin-3-yl)propanamide |
| SMILES | O=C1CCC(NC(=O)CCCl)CN1 |
| InChI | InChI=1S/C8H13ClN2O2/c9-4-3-8(13)11-6-1-2-7(12)10-5-6/h6H,1-5H2,(H,10,12)(H,11,13) |
| InChIKey | DTVJCMBEIAAUDX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|