C12H23IN4O2S — CID 119162139
1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide (PubChem CID 119162139) has the molecular formula C12H23IN4O2S and a molecular weight of 414.31 g/mol. Its IUPAC name is 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide.
| Compound Name | 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119162139 |
| Molecular Formula | C12H23IN4O2S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-[(3-hydroxythiolan-3-yl)methyl]-2-methyl-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1(O)CCSC1)NC1CCC(=O)NC1.I |
| InChI | InChI=1S/C12H22N4O2S.HI/c1-13-11(15-7-12(18)4-5-19-8-12)16-9-2-3-10(17)14-6-9;/h9,18H,2-8H2,1H3,(H,14,17)(H2,13,15,16);1H |
| InChIKey | DQJXDYPDMVAYSH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|