C16H31IN4OS — CID 119162005
1-[1-(cyclopropylmethyl)piperidin-4-yl]-3-[(3-hydroxythiolan-3-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 119162005) has the molecular formula C16H31IN4OS and a molecular weight of 454.42 g/mol. Its IUPAC name is 1-[1-(cyclopropylmethyl)piperidin-4-yl]-3-[(3-hydroxythiolan-3-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[1-(cyclopropylmethyl)piperidin-4-yl]-3-[(3-hydroxythiolan-3-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119162005 |
| Molecular Formula | C16H31IN4OS |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-[1-(cyclopropylmethyl)piperidin-4-yl]-3-[(3-hydroxythiolan-3-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC1(O)CCSC1)NC1CCN(CC2CC2)CC1.I |
| InChI | InChI=1S/C16H30N4OS.HI/c1-17-15(18-11-16(21)6-9-22-12-16)19-14-4-7-20(8-5-14)10-13-2-3-13;/h13-14,21H,2-12H2,1H3,(H2,17,18,19);1H |
| InChIKey | HEJCTYPHWREYOB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|