C15H29IN4O2 — CID 119152554
1-ethyl-2-[(1-hydroxycyclohexyl)methyl]-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide (PubChem CID 119152554) has the molecular formula C15H29IN4O2 and a molecular weight of 424.33 g/mol. Its IUPAC name is 1-ethyl-2-[(1-hydroxycyclohexyl)methyl]-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(1-hydroxycyclohexyl)methyl]-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119152554 |
| Molecular Formula | C15H29IN4O2 |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-ethyl-2-[(1-hydroxycyclohexyl)methyl]-3-(6-oxopiperidin-3-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(O)CCCCC1)NC1CCC(=O)NC1.I |
| InChI | InChI=1S/C15H28N4O2.HI/c1-2-16-14(19-12-6-7-13(20)17-10-12)18-11-15(21)8-4-3-5-9-15;/h12,21H,2-11H2,1H3,(H,17,20)(H2,16,18,19);1H |
| InChIKey | ROFVBYGLESBVBI-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|