C14H27IN4O2 — CID 119156266
1-ethyl-2-[(1-hydroxycyclobutyl)methyl]-3-(1-methyl-6-oxopiperidin-3-yl)guanidine;hydroiodide (PubChem CID 119156266) has the molecular formula C14H27IN4O2 and a molecular weight of 410.30 g/mol. Its IUPAC name is 1-ethyl-2-[(1-hydroxycyclobutyl)methyl]-3-(1-methyl-6-oxopiperidin-3-yl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(1-hydroxycyclobutyl)methyl]-3-(1-methyl-6-oxopiperidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119156266 |
| Molecular Formula | C14H27IN4O2 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-ethyl-2-[(1-hydroxycyclobutyl)methyl]-3-(1-methyl-6-oxopiperidin-3-yl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(O)CCC1)NC1CCC(=O)N(C)C1.I |
| InChI | InChI=1S/C14H26N4O2.HI/c1-3-15-13(16-10-14(20)7-4-8-14)17-11-5-6-12(19)18(2)9-11;/h11,20H,3-10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | OERXCBTYPQNOSB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|