C16H28F3N3O — CID 111990219
1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine (PubChem CID 111990219) has the molecular formula C16H28F3N3O and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine.
| Compound Name | 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine |
|---|---|
| PubChem CID | 111990219 |
| Molecular Formula | C16H28F3N3O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 1-ethyl-2-[(1-hydroxycyclopentyl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine |
| SMILES | CCN/C(=N\CC1(O)CCCC1)NC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H28F3N3O/c1-2-20-14(21-11-15(23)9-3-4-10-15)22-13-7-5-12(6-8-13)16(17,18)19/h12-13,23H,2-11H2,1H3,(H2,20,21,22) |
| InChIKey | BTSMPZXCASNNMV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|