C22H41F3IN5 — CID 111990922
1-ethyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide (PubChem CID 111990922) has the molecular formula C22H41F3IN5 and a molecular weight of 559.50 g/mol. Its IUPAC name is 1-ethyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111990922 |
| Molecular Formula | C22H41F3IN5 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | 1-ethyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-3-[4-(trifluoromethyl)cyclohexyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCCCC2)CCN(C)CC1)NC1CCC(C(F)(F)F)CC1.I |
| InChI | InChI=1S/C22H40F3N5.HI/c1-3-26-20(28-19-9-7-18(8-10-19)22(23,24)25)27-17-21(11-15-29(2)16-12-21)30-13-5-4-6-14-30;/h18-19H,3-17H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | VIASJNPKRGONII-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|