C23H45N7O — CID 111991659
2-[4-[[N-ethyl-N'-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]piperidin-1-yl]-N-methylacetamide (PubChem CID 111991659) has the molecular formula C23H45N7O and a molecular weight of 435.66 g/mol. Its IUPAC name is 2-[4-[[N-ethyl-N'-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]piperidin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-[[N-ethyl-N'-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]piperidin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 111991659 |
| Molecular Formula | C23H45N7O |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.37 |
| IUPAC Name | 2-[4-[[N-ethyl-N'-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]carbamimidoyl]amino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CCN/C(=N\CC1(N2CCCCC2)CCN(C)CC1)NC1CCN(CC(=O)NC)CC1 |
| InChI | InChI=1S/C23H45N7O/c1-4-25-22(27-20-8-14-29(15-9-20)18-21(31)24-2)26-19-23(10-16-28(3)17-11-23)30-12-6-5-7-13-30/h20H,4-19H2,1-3H3,(H,24,31)(H2,25,26,27) |
| InChIKey | RAPDJOXGVKTCQO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|