C22H30N4OS — CID 109410091
1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine (PubChem CID 109410091) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine.
| Compound Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 109410091 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-(3-hydroxy-2-phenylpropyl)-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N2CCSCC2)cc1)NCC(CO)c1ccccc1 |
| InChI | InChI=1S/C22H30N4OS/c1-23-22(25-16-20(17-27)19-5-3-2-4-6-19)24-15-18-7-9-21(10-8-18)26-11-13-28-14-12-26/h2-10,20,27H,11-17H2,1H3,(H2,23,24,25) |
| InChIKey | NLIUUUZVENZDRK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|