C23H34IN5OS — CID 111008660
1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111008660) has the molecular formula C23H34IN5OS and a molecular weight of 555.53 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111008660 |
| Molecular Formula | C23H34IN5OS |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCSCC2)cc1)NCC(c1ccco1)N1CCCC1.I |
| InChI | InChI=1S/C23H33N5OS.HI/c1-24-23(26-18-21(22-5-4-14-29-22)28-10-2-3-11-28)25-17-19-6-8-20(9-7-19)27-12-15-30-16-13-27;/h4-9,14,21H,2-3,10-13,15-18H2,1H3,(H2,24,25,26);1H |
| InChIKey | GCMDXAWOVKZHGK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|