C24H35N5OS — CID 111008663
1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine (PubChem CID 111008663) has the molecular formula C24H35N5OS and a molecular weight of 441.65 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111008663 |
| Molecular Formula | C24H35N5OS |
| Molecular Weight | 441.65 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C24H35N5OS/c1-2-25-24(27-19-22(23-6-5-15-30-23)29-11-3-4-12-29)26-18-20-7-9-21(10-8-20)28-13-16-31-17-14-28/h5-10,15,22H,2-4,11-14,16-19H2,1H3,(H2,25,26,27) |
| InChIKey | LVUOJHQIMCYYFZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 56.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|